![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 1John 1.7 fellowship principle.wpd | 2002-07-17 07:31 | 13K | |
| 1John 1 inductive.wpd | 2002-07-17 07:31 | 91K | |
| 1John 1 some more visual structure notes.wpd | 2002-07-17 07:31 | 24K | |
| 1John 2 inductive.wpd | 2002-07-17 07:31 | 103K | |
| 1 John 2 inductive big picture.wpd | 2002-07-17 07:31 | 4.8K | |
| 1John more notes on the structure of ch 1.wpd.wpd | 2002-07-17 07:31 | 11K | |
| 1 John outline.wpd | 2002-07-17 07:31 | 29K | |
| 1John rough notes trying to get context.wpd | 2002-07-17 07:31 | 26K | |
| 1John text.wpd | 2002-07-17 07:31 | 25K | |
| 1jo2 behind the scenes.wpd | 2002-07-17 07:31 | 3.7K | |
| 1john whole chiasm working notes.wpd | 2002-07-17 07:31 | 34K | |
| 1john whole chiasm working notes1.wpd | 2002-07-17 07:31 | 34K | |
| PFT61B1.TMP | 2002-10-23 12:00 | 34K | |
| Possible 1 John chiasm.1.wpd | 2002-07-17 07:31 | 49K | |
| Possible 1 John chiasm.2.wpd | 2002-07-17 07:31 | 50K | |
| Possible 1 John chiasm.wpd | 2002-07-17 07:31 | 53K | |